Capryloyl glycine is the main component of dermal structural protein and plays an extremely important job in the skin. One of its functions is to balance the pH value. The reason why the skin??s pH is around 5.5 is because it contains various weak acids, proteins and fats. When different ingredients react with the skin??s fatty proteins, these proteins undergo decarboxylation reactions, thereby changing the skin??s pH. Too high or too low pH is not good, especially for acne-prone skin.
Many studies have concluded that skin with acne-prone skin has a higher pH value. The presence of Capryloyl glycine can provide free carboxyl groups and maintain the balance of skin pH.
Description
Capryloyl Glycine CAS #14246-53-8
| Caprylylglycine Basic information |
| Product Name: | Caprylylglycine |
| Synonyms: | Glycine, N-(1-oxooctyl)-;2-octanoylaminoacetic acid;N-Octanoylglycine;CAPRYLYLGLYCINE;N-Capryloylglycine;Einecs 238-122-3;N-Octanoylglycine-d2;CAPRYLOYL GLYCIN |
| CAS: | 14246-53-8 |
| MF: | C10H19NO3 |
| MW: | 201.26 |
| EINECS: | 238-122-3 |
| Product Categories: | |
| Mol File: | 14246-53-8.mol |
 |
|
| Caprylylglycine Chemical Properties |
| Melting point | 102-103 ??C |
| Boiling point | 403.9??28.0 ??C(Predicted) |
| density | 1.036??0.06 g/cm3(Predicted) |
| vapor pressure | 0Pa at 25?? |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | DMSO (Slightly), Methanol (Slightly) |
| form | Solid |
| pka | 3.62??0.10(Predicted) |
| color | White to Off-White |
| Water Solubility | 1.557g/L at 20?? |
| InChI | InChI=1S/C10H19NO3/c1-2-3-4-5-6-7-9(12)11-8-10(13)14/h2-8H2,1H3,(H,11,12)(H,13,14) |
| InChIKey | SAVLIIGUQOSOEP-UHFFFAOYSA-N |
| SMILES | C(O)(=O)CNC(=O)CCCCCCC |
| LogP | 2.052 at 22?? |
| CAS DataBase Reference | 14246-53-8(CAS DataBase Reference) |
| EPA Substance Registry System | Glycine, N-(1-oxooctyl)- (14246-53-8) |
